ChemNet > CAS > 3541-37-5 Benzo[b]thiophene-2-carboxaldehyde
3541-37-5 Benzo[b]thiophene-2-carboxaldehyde
| Nama produk |
Benzo[b]thiophene-2-carboxaldehyde |
| Nama bahasa Inggris |
Benzo[b]thiophene-2-carboxaldehyde; 2-Formylbenzo[b]thiophene; Thianaphthene-2-carboxaldehyde; 1-Benzothiophene-2-carbaldehyde; Benzo[b]thiophene-2-carbaldehyde |
| MF |
C9H6OS |
| Berat Molekul |
162.2083 |
| InChI |
InChI=1/C9H6OS/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-6H |
| CAS NO |
3541-37-5 |
| Struktur Molekul |
![3541-37-5 Benzo[b]thiophene-2-carboxaldehyde](https://images-a.chemnet.com/suppliers/chembase/075/178075.gif)
|
| Kepadatan |
1.3g/cm3 |
| Titik lebur |
32-36℃ |
| Titik didih |
303.2°C at 760 mmHg |
| Indeks bias |
1.719 |
| Titik nyala |
137.2°C |
| Tekanan uap |
0.000944mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S22:;
S24/25:;
|
|
